C22H27FO4 — CID 22793293
(8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22793293) has the molecular formula C22H27FO4 and a molecular weight of 374.45 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22793293 |
| Molecular Formula | C22H27FO4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C=C(F)C4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@H]1C(=O)CO |
| InChI | InChI=1S/C22H27FO4/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-21(15,2)20(13)17(26)9-22(14,3)19(11)18(27)10-24/h4-5,7-8,11,13-14,17,19-20,24,26H,6,9-10H2,1-3H3/t11-,13+,14+,17+,19-,20-,21+,22+/m1/s1 |
| InChIKey | GAKNWNHGESEUIO-SUGOBYDQSA-N |
| XLogP | 2.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |