C30H50O7 — CID 22794408
7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid (PubChem CID 22794408) has the molecular formula C30H50O7 and a molecular weight of 522.72 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 22794408 |
| Molecular Formula | C30H50O7 |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 7-[(1R,2R)-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
| SMILES | CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C30H50O7/c1-2-3-4-5-6-8-15-24-19-20-26(31)25(24)16-9-7-12-21-30(29(32)33,36-27-17-10-13-22-34-27)37-28-18-11-14-23-35-28/h8,15,24-25,27-28H,2-7,9-14,16-23H2,1H3,(H,32,33)/b15-8+/t24-,25+,27?,28?,30?/m0/s1 |
| InChIKey | HEUJEKWXZZMSGN-QYWIKIPYSA-N |
| XLogP | 6.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|