C13H18O9 — CID 22794422
1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxolan-2-yl]propan-2-one (PubChem CID 22794422) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxolan-2-yl]propan-2-one.
| Compound Name | 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxolan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 22794422 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-3,4,5-trihydroxyoxolan-2-yl]propan-2-one |
| SMILES | CC(=O)C(O)[C@H]1O[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C13H18O9/c1-5(14)9(18)10-11(19,6(2)15)12(20,7(3)16)13(21,22-10)8(4)17/h9-10,18-21H,1-4H3/t9?,10-,11-,12-,13-/m1/s1 |
| InChIKey | CYCZZIKTYVIURM-SFPZXJLLSA-N |
| XLogP | -2.75 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |