C5H11NO2 — CID 22795159
(3S,4R)-piperidine-3,4-diol (PubChem CID 22795159) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is (3S,4R)-piperidine-3,4-diol.
| Compound Name | (3S,4R)-piperidine-3,4-diol |
|---|---|
| PubChem CID | 22795159 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (3S,4R)-piperidine-3,4-diol |
| SMILES | O[C@@H]1CCNC[C@@H]1O |
| InChI | InChI=1S/C5H11NO2/c7-4-1-2-6-3-5(4)8/h4-8H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | IZXWMVPZODQBRB-UHNVWZDZSA-N |
| XLogP | -1.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |