C29H44O4 — CID 22795223
methyl (4R)-4-[(8S,9S,10S,13R,14S,17R)-3,7-diacetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 22795223) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is methyl (4R)-4-[(8S,9S,10S,13R,14S,17R)-3,7-diacetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(8S,9S,10S,13R,14S,17R)-3,7-diacetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 22795223 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | methyl (4R)-4-[(8S,9S,10S,13R,14S,17R)-3,7-diacetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(C(C)=O)CC4CC(C(C)=O)CC[C@]4(C)[C@H]3C=C[C@]12C |
| InChI | InChI=1S/C29H44O4/c1-17(7-10-26(32)33-6)23-8-9-24-27-22(19(3)31)16-21-15-20(18(2)30)11-13-28(21,4)25(27)12-14-29(23,24)5/h12,14,17,20-25,27H,7-11,13,15-16H2,1-6H3/t17-,20?,21?,22?,23-,24+,25+,27+,28+,29-/m1/s1 |
| InChIKey | HKPRPISXKKVQKN-XDPOTXPJSA-N |
| XLogP | 6.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|