C20H22N4 — CID 22795685
(6aR,9S)-7-methyl-N-pyridin-3-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine (PubChem CID 22795685) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is (6aR,9S)-7-methyl-N-pyridin-3-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine.
| Compound Name | (6aR,9S)-7-methyl-N-pyridin-3-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine |
|---|---|
| PubChem CID | 22795685 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (6aR,9S)-7-methyl-N-pyridin-3-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine |
| SMILES | CN1C[C@@H](Nc2cccnc2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C20H22N4/c1-24-12-15(23-14-4-3-7-21-11-14)9-17-16-5-2-6-18-20(16)13(10-22-18)8-19(17)24/h2-7,10-11,15,17,19,22-23H,8-9,12H2,1H3/t15-,17?,19+/m0/s1 |
| InChIKey | YTFYAKJCTLIUKC-APROBQCTSA-N |
| XLogP | 3.39 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |