C13H18O6 — CID 22796725
(Z,2R,3R,4S,5R)-7-phenylhept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 22796725) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (Z,2R,3R,4S,5R)-7-phenylhept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (Z,2R,3R,4S,5R)-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 22796725 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (Z,2R,3R,4S,5R)-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)/C(O)=C/c1ccccc1 |
| InChI | InChI=1S/C13H18O6/c14-7-10(16)12(18)13(19)11(17)9(15)6-8-4-2-1-3-5-8/h1-6,10-19H,7H2/b9-6-/t10-,11+,12-,13-/m1/s1 |
| InChIKey | HZVFRKSYUGFFEJ-ABIPOCLWSA-N |
| XLogP | -0.98 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|