C22H32O4S — CID 22796900
(1S,7aS)-4-(benzenesulfonylmethyl)-7a-ethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 22796900) has the molecular formula C22H32O4S and a molecular weight of 392.56 g/mol. Its IUPAC name is (1S,7aS)-4-(benzenesulfonylmethyl)-7a-ethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (1S,7aS)-4-(benzenesulfonylmethyl)-7a-ethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 22796900 |
| Molecular Formula | C22H32O4S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1S,7aS)-4-(benzenesulfonylmethyl)-7a-ethyl-1-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC[C@]12CCC(=O)C(CS(=O)(=O)c3ccccc3)C1CC[C@@H]2OC(C)(C)C |
| InChI | InChI=1S/C22H32O4S/c1-5-22-14-13-19(23)17(15-27(24,25)16-9-7-6-8-10-16)18(22)11-12-20(22)26-21(2,3)4/h6-10,17-18,20H,5,11-15H2,1-4H3/t17?,18?,20-,22-/m0/s1 |
| InChIKey | ORYZEKXTZGBHIO-IQDQWBFVSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |