C21H30O4S — CID 22796906
(7aS)-4-(benzenesulfonylmethyl)-7a-methyl-2-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 22796906) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is (7aS)-4-(benzenesulfonylmethyl)-7a-methyl-2-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (7aS)-4-(benzenesulfonylmethyl)-7a-methyl-2-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 22796906 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (7aS)-4-(benzenesulfonylmethyl)-7a-methyl-2-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC(C)(C)OC1CC2C(CS(=O)(=O)c3ccccc3)C(=O)CC[C@@]2(C)C1 |
| InChI | InChI=1S/C21H30O4S/c1-20(2,3)25-15-12-18-17(19(22)10-11-21(18,4)13-15)14-26(23,24)16-8-6-5-7-9-16/h5-9,15,17-18H,10-14H2,1-4H3/t15?,17?,18?,21-/m0/s1 |
| InChIKey | VTYJPGXJVPBBEM-RVVARTGISA-N |
| XLogP | 4.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |