C21H34 — CID 22797461
(1S,7R,8S,9S,10R,13S,14S)-1,7,10,13-tetramethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 22797461) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (1S,7R,8S,9S,10R,13S,14S)-1,7,10,13-tetramethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (1S,7R,8S,9S,10R,13S,14S)-1,7,10,13-tetramethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22797461 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (1S,7R,8S,9S,10R,13S,14S)-1,7,10,13-tetramethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@H]1CC2=CCC[C@H](C)[C@]2(C)[C@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C21H34/c1-14-13-16-8-5-7-15(2)21(16,4)18-10-12-20(3)11-6-9-17(20)19(14)18/h8,14-15,17-19H,5-7,9-13H2,1-4H3/t14-,15+,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | IEOFCAFCTFRGAH-GORNDXOVSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|