About (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene
(3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene (PubChem CID 22798321) has the molecular formula C12H22S
and a molecular weight of 198.37 g/mol. Its IUPAC name is (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene.
Molecular Properties
| Compound Name | (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene |
| PubChem CID | 22798321 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene |
| SMILES | CC/C=C/C(C/C(C)=C/CC)SC |
| InChI | InChI=1S/C12H22S/c1-5-7-9-12(13-4)10-11(3)8-6-2/h7-9,12H,5-6,10H2,1-4H3/b9-7+,11-8+ |
| InChIKey | VIAVYGAURXVIHO-BIZFVBGRSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene?
The IUPAC name of (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene (CID 22798321) is (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene.
What is the SMILES notation for (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene?
The canonical SMILES for (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene is CC/C=C/C(C/C(C)=C/CC)SC.
What is the InChIKey of (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene?
The InChIKey is VIAVYGAURXVIHO-BIZFVBGRSA-N. The full InChI is InChI=1S/C12H22S/c1-5-7-9-12(13-4)10-11(3)8-6-2/h7-9,12H,5-6,10H2,1-4H3/b9-7+,11-8+.
What are the key properties of (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene?
(3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene has a molecular weight of 198.37 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,7E)-4-methyl-6-methylsulfanyldeca-3,7-diene is sourced from PubChem (CID 22798321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).