C24H37NO5 — CID 22798421
(E)-7-[(7S)-7-cyano-8-[(E)-3-hydroxy-3-methyloct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid (PubChem CID 22798421) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is (E)-7-[(7S)-7-cyano-8-[(E)-3-hydroxy-3-methyloct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[(7S)-7-cyano-8-[(E)-3-hydroxy-3-methyloct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 22798421 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | (E)-7-[(7S)-7-cyano-8-[(E)-3-hydroxy-3-methyloct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
| SMILES | CCCCCC(C)(O)/C=C/C1C(C/C=C/CCCC(=O)O)C2(C[C@@H]1C#N)OCCO2 |
| InChI | InChI=1S/C24H37NO5/c1-3-4-9-13-23(2,28)14-12-20-19(18-25)17-24(29-15-16-30-24)21(20)10-7-5-6-8-11-22(26)27/h5,7,12,14,19-21,28H,3-4,6,8-11,13,15-17H2,1-2H3,(H,26,27)/b7-5+,14-12+/t19-,20?,21?,23?/m1/s1 |
| InChIKey | NXVZYBDRFTYCOO-ILCQDJPKSA-N |
| XLogP | 4.59 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|