C8H17NO5 — CID 22798438
(2R,3R,4S,5R)-2-(dimethylamino)-3,4,5,6-tetrahydroxyhexanal (PubChem CID 22798438) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(dimethylamino)-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3R,4S,5R)-2-(dimethylamino)-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 22798438 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-(dimethylamino)-3,4,5,6-tetrahydroxyhexanal |
| SMILES | CN(C)[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H17NO5/c1-9(2)5(3-10)7(13)8(14)6(12)4-11/h3,5-8,11-14H,4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | XGTOSDKCLWLMAC-LXGUWJNJSA-N |
| XLogP | -2.81 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|