C22H23BrN4 — CID 22798505
N-[[(6aR,9S)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]-6-bromopyridin-3-amine (PubChem CID 22798505) has the molecular formula C22H23BrN4 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[[(6aR,9S)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]-6-bromopyridin-3-amine.
| Compound Name | N-[[(6aR,9S)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]-6-bromopyridin-3-amine |
|---|---|
| PubChem CID | 22798505 |
| Molecular Formula | C22H23BrN4 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[[(6aR,9S)-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinolin-9-yl]methyl]-6-bromopyridin-3-amine |
| SMILES | CN1C[C@H](CNc2ccc(Br)nc2)C=C2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C22H23BrN4/c1-26-12-14(10-24-16-6-7-21(23)25-11-16)8-18-17-4-3-5-19-22(17)15(9-20(18)26)13-27(19)2/h3-8,11,13-14,20,24H,9-10,12H2,1-2H3/t14-,20+/m0/s1 |
| InChIKey | AMUUPGPJXHUADN-VBKZILBWSA-N |
| XLogP | 4.32 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|