C18H14Cl5IN2O3S2 — CID 22798635
2,2,2-trichloroethyl (6S)-7-[[2-(2,5-dichlorophenyl)ethanethioyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 22798635) has the molecular formula C18H14Cl5IN2O3S2 and a molecular weight of 674.62 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-7-[[2-(2,5-dichlorophenyl)ethanethioyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-7-[[2-(2,5-dichlorophenyl)ethanethioyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 22798635 |
| Molecular Formula | C18H14Cl5IN2O3S2 |
| Molecular Weight | 674.62 g/mol |
| Exact Mass | 671.79 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-7-[[2-(2,5-dichlorophenyl)ethanethioyl]amino]-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)C1C(CI)=CS[C@H]2C(NC(=S)Cc3cc(Cl)ccc3Cl)C(=O)N12 |
| InChI | InChI=1S/C18H14Cl5IN2O3S2/c19-10-1-2-11(20)8(3-10)4-12(30)25-13-15(27)26-14(9(5-24)6-31-16(13)26)17(28)29-7-18(21,22)23/h1-3,6,13-14,16H,4-5,7H2,(H,25,30)/t13?,14?,16-/m0/s1 |
| InChIKey | BUFLZEZUNMTBHG-XUJLQICISA-N |
| XLogP | 5.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|