C15H21N — CID 22798952
(3aR,7aS)-2-methyl-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-isoindole (PubChem CID 22798952) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (3aR,7aS)-2-methyl-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-isoindole.
| Compound Name | (3aR,7aS)-2-methyl-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 22798952 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (3aR,7aS)-2-methyl-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
| SMILES | CN1C[C@@H]2CCCC[C@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C15H21N/c1-16-11-14-9-5-6-10-15(14,12-16)13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | KOMUTRYSVZSJSV-LSDHHAIUSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |