C22H30O4S — CID 22799486
(4aS,5S)-1-(benzenesulfonylmethyl)-4a-methyl-5-[(2-methylpropan-2-yl)oxy]-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 22799486) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is (4aS,5S)-1-(benzenesulfonylmethyl)-4a-methyl-5-[(2-methylpropan-2-yl)oxy]-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,5S)-1-(benzenesulfonylmethyl)-4a-methyl-5-[(2-methylpropan-2-yl)oxy]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 22799486 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (4aS,5S)-1-(benzenesulfonylmethyl)-4a-methyl-5-[(2-methylpropan-2-yl)oxy]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC(C)(C)O[C@H]1CCCC2=C(CS(=O)(=O)c3ccccc3)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C22H30O4S/c1-21(2,3)26-20-12-8-11-18-17(19(23)13-14-22(18,20)4)15-27(24,25)16-9-6-5-7-10-16/h5-7,9-10,20H,8,11-15H2,1-4H3/t20-,22-/m0/s1 |
| InChIKey | GEYZAOAIULLPGG-UNMCSNQZSA-N |
| XLogP | 4.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |