C18H15IN2O6S — CID 22799533
2-iodoethyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22799533) has the molecular formula C18H15IN2O6S and a molecular weight of 514.30 g/mol. Its IUPAC name is 2-iodoethyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 2-iodoethyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22799533 |
| Molecular Formula | C18H15IN2O6S |
| Molecular Weight | 514.30 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 2-iodoethyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@H]2C(N3C(=O)c4ccccc4C3=O)C(=O)N2C1C(=O)OCCI |
| InChI | InChI=1S/C18H15IN2O6S/c1-9-8-28(26)17-13(16(24)21(17)12(9)18(25)27-7-6-19)20-14(22)10-4-2-3-5-11(10)15(20)23/h2-5,12-13,17H,1,6-8H2/t12?,13?,17-,28?/m0/s1 |
| InChIKey | GQLKORFQLOESPV-CBQFCURZSA-N |
| XLogP | 0.48 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|