About (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid
(2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid (PubChem CID 22800645) has the molecular formula C10H18N2O5S
and a molecular weight of 278.33 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid |
| PubChem CID | 22800645 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid |
| SMILES | CSCC[C@H](N)C(=O)O.O=C(O)N1CCCC1=O |
| InChI | InChI=1S/C5H7NO3.C5H11NO2S/c7-4-2-1-3-6(4)5(8)9;1-9-3-2-4(6)5(7)8/h1-3H2,(H,8,9);4H,2-3,6H2,1H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | BDTXXHOYBPKDIN-VWMHFEHESA-N |
| XLogP | 0.44 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid?
The IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid (CID 22800645) is (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid.
What is the SMILES notation for (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid?
The canonical SMILES for (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid is CSCC[C@H](N)C(=O)O.O=C(O)N1CCCC1=O.
What is the InChIKey of (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid?
The InChIKey is BDTXXHOYBPKDIN-VWMHFEHESA-N. The full InChI is InChI=1S/C5H7NO3.C5H11NO2S/c7-4-2-1-3-6(4)5(8)9;1-9-3-2-4(6)5(7)8/h1-3H2,(H,8,9);4H,2-3,6H2,1H3,(H,7,8)/t;4-/m.0/s1.
What are the key properties of (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid?
(2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid has a molecular weight of 278.33 g/mol, XLogP of 0.44, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylsulfanylbutanoic acid;2-oxopyrrolidine-1-carboxylic acid is sourced from PubChem (CID 22800645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).