C34H58O7 — CID 22800690
7-[(1R,2R,5R)-2-hydroxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2-methyl-2,3-bis(oxan-2-yloxy)heptanoic acid (PubChem CID 22800690) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is 7-[(1R,2R,5R)-2-hydroxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2-methyl-2,3-bis(oxan-2-yloxy)heptanoic acid.
| Compound Name | 7-[(1R,2R,5R)-2-hydroxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2-methyl-2,3-bis(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 22800690 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | 7-[(1R,2R,5R)-2-hydroxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2-methyl-2,3-bis(oxan-2-yloxy)heptanoic acid |
| SMILES | CC(C)=CCCCCC/C=C/[C@H]1CC[C@@H](O)[C@@H]1CCCCC(OC1CCCCO1)C(C)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C34H58O7/c1-26(2)16-8-6-4-5-7-9-17-27-22-23-29(35)28(27)18-10-11-19-30(40-31-20-12-14-24-38-31)34(3,33(36)37)41-32-21-13-15-25-39-32/h9,16-17,27-32,35H,4-8,10-15,18-25H2,1-3H3,(H,36,37)/b17-9+/t27-,28+,29+,30?,31?,32?,34?/m0/s1 |
| InChIKey | JFWASHWGPPBEJR-FSAAXLEUSA-N |
| XLogP | 7.71 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|