C34H56O7 — CID 22800692
2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]-2,3-bis(oxan-2-yloxy)heptanoic acid (PubChem CID 22800692) has the molecular formula C34H56O7 and a molecular weight of 576.82 g/mol. Its IUPAC name is 2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]-2,3-bis(oxan-2-yloxy)heptanoic acid.
| Compound Name | 2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]-2,3-bis(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 22800692 |
| Molecular Formula | C34H56O7 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | 2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]-2,3-bis(oxan-2-yloxy)heptanoic acid |
| SMILES | CC(C)=CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCC(OC1CCCCO1)C(C)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C34H56O7/c1-26(2)16-8-6-4-5-7-9-17-27-22-23-29(35)28(27)18-10-11-19-30(40-31-20-12-14-24-38-31)34(3,33(36)37)41-32-21-13-15-25-39-32/h9,16-17,27-28,30-32H,4-8,10-15,18-25H2,1-3H3,(H,36,37)/b17-9+/t27-,28+,30?,31?,32?,34?/m0/s1 |
| InChIKey | CMHDSEZYRSGGQQ-DWFQSCMLSA-N |
| XLogP | 7.91 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|