C23H38O4 — CID 22800696
2-hydroxy-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 22800696) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-hydroxy-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22800696 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2-hydroxy-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C)=CCCCCC/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCC(O)C(=O)O |
| InChI | InChI=1S/C23H38O4/c1-18(2)12-8-5-3-4-6-9-13-19-16-17-21(24)20(19)14-10-7-11-15-22(25)23(26)27/h9,12-13,19-20,22,25H,3-8,10-11,14-17H2,1-2H3,(H,26,27)/b13-9+/t19-,20+,22?/m0/s1 |
| InChIKey | ZSWGJZGZOVYMNL-ZMLWNBSPSA-N |
| XLogP | 5.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|