C27H46O6 — CID 22800700
methyl 7-[(1R,2R,5R)-2-acetyloxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2,3-dihydroxy-2-methylheptanoate (PubChem CID 22800700) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is methyl 7-[(1R,2R,5R)-2-acetyloxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2,3-dihydroxy-2-methylheptanoate.
| Compound Name | methyl 7-[(1R,2R,5R)-2-acetyloxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2,3-dihydroxy-2-methylheptanoate |
|---|---|
| PubChem CID | 22800700 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | methyl 7-[(1R,2R,5R)-2-acetyloxy-5-[(1E)-9-methyldeca-1,8-dienyl]cyclopentyl]-2,3-dihydroxy-2-methylheptanoate |
| SMILES | COC(=O)C(C)(O)C(O)CCCC[C@@H]1[C@@H](/C=C/CCCCCC=C(C)C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H46O6/c1-20(2)14-10-8-6-7-9-11-15-22-18-19-24(33-21(3)28)23(22)16-12-13-17-25(29)27(4,31)26(30)32-5/h11,14-15,22-25,29,31H,6-10,12-13,16-19H2,1-5H3/b15-11+/t22-,23+,24+,25?,27?/m0/s1 |
| InChIKey | QPWBYNKQQWNWIN-QVJQVKSLSA-N |
| XLogP | 5.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|