C25H42O5 — CID 22800707
methyl 2,3-dihydroxy-2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22800707) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 2,3-dihydroxy-2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22800707 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | methyl 2,3-dihydroxy-2-methyl-7-[(1R,2R)-2-[(1E)-9-methyldeca-1,8-dienyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)C(C)(O)C(O)CCCC[C@H]1C(=O)CC[C@@H]1/C=C/CCCCCC=C(C)C |
| InChI | InChI=1S/C25H42O5/c1-19(2)13-9-7-5-6-8-10-14-20-17-18-22(26)21(20)15-11-12-16-23(27)25(3,29)24(28)30-4/h10,13-14,20-21,23,27,29H,5-9,11-12,15-18H2,1-4H3/b14-10+/t20-,21+,23?,25?/m0/s1 |
| InChIKey | WOJYMYRNMZVIKW-NHVQRGDSSA-N |
| XLogP | 4.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|