About 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol
2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol (PubChem CID 22801899) has the molecular formula C15H21Br2NO2
and a molecular weight of 407.15 g/mol. Its IUPAC name is 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol |
| PubChem CID | 22801899 |
| Molecular Formula | C15H21Br2NO2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol |
| SMILES | CCN(Cc1cc(Br)c(O)c(Br)c1)[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C15H21Br2NO2/c1-2-18(11-4-3-5-12(19)8-11)9-10-6-13(16)15(20)14(17)7-10/h6-7,11-12,19-20H,2-5,8-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | AYTKFASRBYDTBB-NEPJUHHUSA-N |
| XLogP | 4.04 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol?
The IUPAC name of 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol (CID 22801899) is 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol.
What is the SMILES notation for 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol?
The canonical SMILES for 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol is CCN(Cc1cc(Br)c(O)c(Br)c1)[C@@H]1CCC[C@H](O)C1.
What is the InChIKey of 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol?
The InChIKey is AYTKFASRBYDTBB-NEPJUHHUSA-N. The full InChI is InChI=1S/C15H21Br2NO2/c1-2-18(11-4-3-5-12(19)8-11)9-10-6-13(16)15(20)14(17)7-10/h6-7,11-12,19-20H,2-5,8-9H2,1H3/t11-,12+/m1/s1.
What are the key properties of 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol?
2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol has a molecular weight of 407.15 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-[[ethyl-[(1R,3S)-3-hydroxycyclohexyl]amino]methyl]phenol is sourced from PubChem (CID 22801899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).