About 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol
2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol (PubChem CID 22801901) has the molecular formula C14H19Br2NO2
and a molecular weight of 393.12 g/mol. Its IUPAC name is 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol |
| PubChem CID | 22801901 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol |
| SMILES | CN(Cc1cc(Br)c(O)c(Br)c1)[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C14H19Br2NO2/c1-17(10-3-2-4-11(18)7-10)8-9-5-12(15)14(19)13(16)6-9/h5-6,10-11,18-19H,2-4,7-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | OHHRTJWSBMOCMX-MNOVXSKESA-N |
| XLogP | 3.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol?
The IUPAC name of 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol (CID 22801901) is 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol.
What is the SMILES notation for 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol?
The canonical SMILES for 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol is CN(Cc1cc(Br)c(O)c(Br)c1)[C@@H]1CCC[C@H](O)C1.
What is the InChIKey of 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol?
The InChIKey is OHHRTJWSBMOCMX-MNOVXSKESA-N. The full InChI is InChI=1S/C14H19Br2NO2/c1-17(10-3-2-4-11(18)7-10)8-9-5-12(15)14(19)13(16)6-9/h5-6,10-11,18-19H,2-4,7-8H2,1H3/t10-,11+/m1/s1.
What are the key properties of 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol?
2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol has a molecular weight of 393.12 g/mol, XLogP of 3.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-[[[(1R,3S)-3-hydroxycyclohexyl]-methylamino]methyl]phenol is sourced from PubChem (CID 22801901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).