C12H20O7 — CID 22801962
(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoic acid (PubChem CID 22801962) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 22801962 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-prop-2-enoxy-2-prop-2-enylhexanoic acid |
| SMILES | C=CCO[C@@](CC=C)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H20O7/c1-3-5-12(11(17)18,19-6-4-2)10(16)9(15)8(14)7-13/h3-4,8-10,13-16H,1-2,5-7H2,(H,17,18)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | DRPMUNIZPCNNFH-MWGHHZFTSA-N |
| XLogP | -1.34 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|