C18H32O6S — CID 22802400
7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22802400) has the molecular formula C18H32O6S and a molecular weight of 376.52 g/mol. Its IUPAC name is 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22802400 |
| Molecular Formula | C18H32O6S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCOCC(C)(O)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O6S/c1-3-24-11-18(2,23)12-25-17-13(14(19)10-15(17)20)8-6-4-5-7-9-16(21)22/h13,15,17,20,23H,3-12H2,1-2H3,(H,21,22)/t13-,15?,17+,18?/m0/s1 |
| InChIKey | MRVAUCCMAUTCHW-JRMFLYLOSA-N |
| XLogP | 2.25 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|