C26H39FO5S — CID 22802429
7-[(1S,2R)-2-[2-[(4-fluorophenyl)methyl]-2-hydroxyheptyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22802429) has the molecular formula C26H39FO5S and a molecular weight of 482.66 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[2-[(4-fluorophenyl)methyl]-2-hydroxyheptyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-2-[2-[(4-fluorophenyl)methyl]-2-hydroxyheptyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22802429 |
| Molecular Formula | C26H39FO5S |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 7-[(1S,2R)-2-[2-[(4-fluorophenyl)methyl]-2-hydroxyheptyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCC(O)(CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H39FO5S/c1-2-3-8-15-26(32,17-19-11-13-20(27)14-12-19)18-33-25-21(22(28)16-23(25)29)9-6-4-5-7-10-24(30)31/h11-14,21,23,25,29,32H,2-10,15-18H2,1H3,(H,30,31)/t21-,23?,25+,26?/m0/s1 |
| InChIKey | DPAUNLCJLGZQEL-FHACEZIRSA-N |
| XLogP | 5.16 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|