About butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate
butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate (PubChem CID 22802777) has the molecular formula C29H26N2O5
and a molecular weight of 482.54 g/mol. Its IUPAC name is butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate.
Molecular Properties
| Compound Name | butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate |
| PubChem CID | 22802777 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@H](N2C(=O)c3ccccc3C2=O)C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O5/c1-2-3-18-36-29(35)25-24(31-26(32)21-16-10-11-17-22(21)27(31)33)28(34)30(25)23(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23-25H,2-3,18H2,1H3/t24-,25-/m0/s1 |
| InChIKey | KHZHVFRBCSJFSJ-DQEYMECFSA-N |
| XLogP | 3.99 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate?
The IUPAC name of butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate (CID 22802777) is butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate.
What is the SMILES notation for butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate?
The canonical SMILES for butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate is CCCCOC(=O)[C@@H]1[C@H](N2C(=O)c3ccccc3C2=O)C(=O)N1C(c1ccccc1)c1ccccc1.
What is the InChIKey of butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate?
The InChIKey is KHZHVFRBCSJFSJ-DQEYMECFSA-N. The full InChI is InChI=1S/C29H26N2O5/c1-2-3-18-36-29(35)25-24(31-26(32)21-16-10-11-17-22(21)27(31)33)28(34)30(25)23(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23-25H,2-3,18H2,1H3/t24-,25-/m0/s1.
What are the key properties of butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate?
butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate has a molecular weight of 482.54 g/mol, XLogP of 3.99, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2S,3S)-1-benzhydryl-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carboxylate is sourced from PubChem (CID 22802777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).