C23H36O5 — CID 22803311
(E)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid (PubChem CID 22803311) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 22803311 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (E)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-3-(3-propylcyclopentyl)prop-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
| SMILES | CCCC1CCC([C@H](O)/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2CCCC/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C23H36O5/c1-2-7-16-10-11-17(14-16)20(24)13-12-19-18(21(25)15-22(19)26)8-5-3-4-6-9-23(27)28/h6,9,12-13,16-20,22,24,26H,2-5,7-8,10-11,14-15H2,1H3,(H,27,28)/b9-6+,13-12+/t16?,17?,18-,19-,20-,22-/m1/s1 |
| InChIKey | SZFCGCGRUXEMDD-CPKYLYSLSA-N |
| XLogP | 3.89 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|