C27H25F3O7 — CID 22803349
[(3aR,4R,5R,6aS)-2-oxo-4-[(E)-2-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 22803349) has the molecular formula C27H25F3O7 and a molecular weight of 518.48 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-2-oxo-4-[(E)-2-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-2-oxo-4-[(E)-2-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 22803349 |
| Molecular Formula | C27H25F3O7 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [(3aR,4R,5R,6aS)-2-oxo-4-[(E)-2-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/C3(COc4cccc(C(F)(F)F)c4)OCCO3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C27H25F3O7/c28-27(29,30)18-7-4-8-19(13-18)33-16-26(34-11-12-35-26)10-9-20-21-14-24(31)36-23(21)15-22(20)37-25(32)17-5-2-1-3-6-17/h1-10,13,20-23H,11-12,14-16H2/b10-9+/t20-,21-,22-,23+/m1/s1 |
| InChIKey | CYRVQCXJLOLFBV-UWEHDAPCSA-N |
| XLogP | 4.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|