C26H25FO7 — CID 22803355
[(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 22803355) has the molecular formula C26H25FO7 and a molecular weight of 468.48 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 22803355 |
| Molecular Formula | C26H25FO7 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(E)-2-[2-[(4-fluorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/C3(COc4ccc(F)cc4)OCCO3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C26H25FO7/c27-18-6-8-19(9-7-18)30-16-26(31-12-13-32-26)11-10-20-21-14-24(28)33-23(21)15-22(20)34-25(29)17-4-2-1-3-5-17/h1-11,20-23H,12-16H2/b11-10+/t20-,21-,22-,23+/m1/s1 |
| InChIKey | QWUDLWSKCURLSY-QPWWTBIYSA-N |
| XLogP | 3.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|