C16H26O6 — CID 22803371
(3aR,4R,5R,6aS)-4-[(E)-2-[2-(propoxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 22803371) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-2-[2-(propoxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-(propoxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 22803371 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-2-[2-(propoxymethyl)-1,3-dioxolan-2-yl]ethenyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CCCOCC1(/C=C/[C@@H]2[C@H]3CC(O)O[C@H]3C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C16H26O6/c1-2-5-19-10-16(20-6-7-21-16)4-3-11-12-8-15(18)22-14(12)9-13(11)17/h3-4,11-15,17-18H,2,5-10H2,1H3/b4-3+/t11-,12-,13-,14+,15?/m1/s1 |
| InChIKey | XTKFMKMJFCTYSX-OZVSZOGWSA-N |
| XLogP | 0.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|