C23H36O4S — CID 22803711
1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)-4-methyloctan-2-ol (PubChem CID 22803711) has the molecular formula C23H36O4S and a molecular weight of 408.60 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)-4-methyloctan-2-ol.
| Compound Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)-4-methyloctan-2-ol |
|---|---|
| PubChem CID | 22803711 |
| Molecular Formula | C23H36O4S |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)-4-methyloctan-2-ol |
| SMILES | CCCCC(C)CC(O)C(C1CC[C@H]2OC(OC)C[C@@H]12)S(=O)c1ccccc1 |
| InChI | InChI=1S/C23H36O4S/c1-4-5-9-16(2)14-20(24)23(28(25)17-10-7-6-8-11-17)18-12-13-21-19(18)15-22(26-3)27-21/h6-8,10-11,16,18-24H,4-5,9,12-15H2,1-3H3/t16?,18?,19-,20?,21+,22?,23?,28?/m0/s1 |
| InChIKey | SVLMUIQLZPMBSN-MXAJUNSYSA-N |
| XLogP | 4.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |