C18H26O4S — CID 22803713
1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)butan-2-ol (PubChem CID 22803713) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)butan-2-ol.
| Compound Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)butan-2-ol |
|---|---|
| PubChem CID | 22803713 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)butan-2-ol |
| SMILES | CCC(O)C(C1CC[C@H]2OC(OC)C[C@@H]12)S(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O4S/c1-3-15(19)18(23(20)12-7-5-4-6-8-12)13-9-10-16-14(13)11-17(21-2)22-16/h4-8,13-19H,3,9-11H2,1-2H3/t13?,14-,15?,16+,17?,18?,23?/m0/s1 |
| InChIKey | FLIDHCNLHDVEMP-HYACGJCQSA-N |
| XLogP | 2.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |