C22H34O4S — CID 22803714
1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)octan-2-ol (PubChem CID 22803714) has the molecular formula C22H34O4S and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)octan-2-ol.
| Compound Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)octan-2-ol |
|---|---|
| PubChem CID | 22803714 |
| Molecular Formula | C22H34O4S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[(3aS,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-1-(benzenesulfinyl)octan-2-ol |
| SMILES | CCCCCCC(O)C(C1CC[C@H]2OC(OC)C[C@@H]12)S(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O4S/c1-3-4-5-9-12-19(23)22(27(24)16-10-7-6-8-11-16)17-13-14-20-18(17)15-21(25-2)26-20/h6-8,10-11,17-23H,3-5,9,12-15H2,1-2H3/t17?,18-,19?,20+,21?,22?,27?/m0/s1 |
| InChIKey | IMVACZWSFQDARF-RCLUBBJBSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|