C22H34O5S — CID 22803715
(3aS,6aR)-4-[1-(benzenesulfinyl)-2-hydroxyoctyl]-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 22803715) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is (3aS,6aR)-4-[1-(benzenesulfinyl)-2-hydroxyoctyl]-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (3aS,6aR)-4-[1-(benzenesulfinyl)-2-hydroxyoctyl]-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 22803715 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3aS,6aR)-4-[1-(benzenesulfinyl)-2-hydroxyoctyl]-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | CCCCCCC(O)C(C1C(O)C[C@H]2OC(OC)C[C@@H]12)S(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O5S/c1-3-4-5-9-12-17(23)22(28(25)15-10-7-6-8-11-15)21-16-13-20(26-2)27-19(16)14-18(21)24/h6-8,10-11,16-24H,3-5,9,12-14H2,1-2H3/t16-,17?,18?,19-,20?,21?,22?,28?/m1/s1 |
| InChIKey | AJNBEKKSDRTRJS-CCQARPBYSA-N |
| XLogP | 3.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|