C21H35BrO4 — CID 22803782
(3S,5S,8R,9S,10R,13R,14S,15S,17S)-15-bromo-17-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 22803782) has the molecular formula C21H35BrO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is (3S,5S,8R,9S,10R,13R,14S,15S,17S)-15-bromo-17-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (3S,5S,8R,9S,10R,13R,14S,15S,17S)-15-bromo-17-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 22803782 |
| Molecular Formula | C21H35BrO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (3S,5S,8R,9S,10R,13R,14S,15S,17S)-15-bromo-17-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@H](O)[C@H]1C[C@H](Br)[C@]2(O)[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(CO)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H35BrO4/c1-12(24)17-10-18(22)21(26)16-4-3-13-9-14(25)5-8-20(13,11-23)15(16)6-7-19(17,21)2/h12-18,23-26H,3-11H2,1-2H3/t12-,13-,14-,15-,16+,17+,18-,19+,20+,21+/m0/s1 |
| InChIKey | LAUOAACHJNFLIW-NIMAUANHSA-N |
| XLogP | 2.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|