C24H44N2 — CID 22804083
(5E,9E)-3,12-diheptyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 22804083) has the molecular formula C24H44N2 and a molecular weight of 360.63 g/mol. Its IUPAC name is (5E,9E)-3,12-diheptyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5E,9E)-3,12-diheptyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 22804083 |
| Molecular Formula | C24H44N2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.35 |
| IUPAC Name | (5E,9E)-3,12-diheptyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCCCCCCC1C/C=C/CC/C=C/CC(CCCCCCC)/N=N/1 |
| InChI | InChI=1S/C24H44N2/c1-3-5-7-11-15-19-23-21-17-13-9-10-14-18-22-24(26-25-23)20-16-12-8-6-4-2/h13-14,17-18,23-24H,3-12,15-16,19-22H2,1-2H3/b17-13+,18-14+,26-25+ |
| InChIKey | XSYJZWZBBOLBSY-SILJGQKISA-N |
| XLogP | 8.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|