About cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride
cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride (PubChem CID 22805448) has the molecular formula C12H23ClN2O2
and a molecular weight of 262.78 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride |
| PubChem CID | 22805448 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@H]1CCCC[C@H]1N(C)/C=N/C.Cl |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-4-16-12(15)10-7-5-6-8-11(10)14(3)9-13-2;/h9-11H,4-8H2,1-3H3;1H/b13-9+;/t10-,11+;/m0./s1 |
| InChIKey | DVICPZAUCMBRBA-NNIHCANMSA-N |
| XLogP | 2.12 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride?
The IUPAC name of cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride (CID 22805448) is cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride.
What is the SMILES notation for cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride?
The canonical SMILES for cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride is CCOC(=O)[C@H]1CCCC[C@H]1N(C)/C=N/C.Cl.
What is the InChIKey of cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride?
The InChIKey is DVICPZAUCMBRBA-NNIHCANMSA-N. The full InChI is InChI=1S/C12H22N2O2.ClH/c1-4-16-12(15)10-7-5-6-8-11(10)14(3)9-13-2;/h9-11H,4-8H2,1-3H3;1H/b13-9+;/t10-,11+;/m0./s1.
What are the key properties of cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride?
cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride has a molecular weight of 262.78 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-[methyl(methyliminomethyl)amino]cyclohexane-1-carboxylate;hydrochloride is sourced from PubChem (CID 22805448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).