C25H32O5 — CID 22805945
[(8S,9S,10R,11S,13S,14S,16R,17S)-17-acetyl-11-hydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 22805945) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,16R,17S)-17-acetyl-11-hydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,16R,17S)-17-acetyl-11-hydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 22805945 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,16R,17S)-17-acetyl-11-hydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@@]1(C(C)=O)[C@H](C)C[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H32O5/c1-6-21(29)30-25(15(3)26)14(2)11-19-18-8-7-16-12-17(27)9-10-23(16,4)22(18)20(28)13-24(19,25)5/h7-10,12,14,18-20,22,28H,6,11,13H2,1-5H3/t14-,18+,19+,20+,22-,23+,24+,25-/m1/s1 |
| InChIKey | YLVWUBATKUYGJV-ODFWSNTNSA-N |
| XLogP | 3.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |