C21H26BrFO6 — CID 22806061
(7R,8S,9R,10S,11S,13S,14S,16R,17S)-7-bromo-9-fluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22806061) has the molecular formula C21H26BrFO6 and a molecular weight of 473.34 g/mol. Its IUPAC name is (7R,8S,9R,10S,11S,13S,14S,16R,17S)-7-bromo-9-fluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8S,9R,10S,11S,13S,14S,16R,17S)-7-bromo-9-fluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22806061 |
| Molecular Formula | C21H26BrFO6 |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (7R,8S,9R,10S,11S,13S,14S,16R,17S)-7-bromo-9-fluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1C[C@@H](Br)[C@H]1[C@@H]3C[C@@H](O)[C@](O)(C(=O)CO)[C@@]3(C)C[C@H](O)[C@@]12F |
| InChI | InChI=1S/C21H26BrFO6/c1-18-4-3-11(25)5-10(18)6-13(22)17-12-7-14(26)21(29,16(28)9-24)19(12,2)8-15(27)20(17,18)23/h3-5,12-15,17,24,26-27,29H,6-9H2,1-2H3/t12-,13+,14+,15-,17+,18-,19-,20+,21-/m0/s1 |
| InChIKey | FMHXFQMCENRJKL-CQOMAYTQSA-N |
| XLogP | 0.99 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|