About (3S,5R)-thiane-3,4,5-triol
(3S,5R)-thiane-3,4,5-triol (PubChem CID 22806412) has the molecular formula C5H10O3S
and a molecular weight of 150.20 g/mol. Its IUPAC name is (3S,5R)-thiane-3,4,5-triol.
Molecular Properties
| Compound Name | (3S,5R)-thiane-3,4,5-triol |
| PubChem CID | 22806412 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (3S,5R)-thiane-3,4,5-triol |
| SMILES | OC1[C@H](O)CSC[C@@H]1O |
| InChI | InChI=1S/C5H10O3S/c6-3-1-9-2-4(7)5(3)8/h3-8H,1-2H2/t3-,4+,5? |
| InChIKey | SYMYXGBPLSRIAP-NGQZWQHPSA-N |
| XLogP | -1.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,5R)-thiane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-thiane-3,4,5-triol?
The IUPAC name of (3S,5R)-thiane-3,4,5-triol (CID 22806412) is (3S,5R)-thiane-3,4,5-triol.
What is the SMILES notation for (3S,5R)-thiane-3,4,5-triol?
The canonical SMILES for (3S,5R)-thiane-3,4,5-triol is OC1[C@H](O)CSC[C@@H]1O.
What is the InChIKey of (3S,5R)-thiane-3,4,5-triol?
The InChIKey is SYMYXGBPLSRIAP-NGQZWQHPSA-N. The full InChI is InChI=1S/C5H10O3S/c6-3-1-9-2-4(7)5(3)8/h3-8H,1-2H2/t3-,4+,5?.
What are the key properties of (3S,5R)-thiane-3,4,5-triol?
(3S,5R)-thiane-3,4,5-triol has a molecular weight of 150.20 g/mol, XLogP of -1.18, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-thiane-3,4,5-triol is sourced from PubChem (CID 22806412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).