About (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol
(1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol (PubChem CID 22806486) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol.
Molecular Properties
| Compound Name | (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol |
| PubChem CID | 22806486 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol |
| SMILES | NCCC1=CC[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H15NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1,7-8,10-11H,2-5,9H2/t7-,8+/m1/s1 |
| InChIKey | CTFLQTXFACAEGL-SFYZADRCSA-N |
| XLogP | -0.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol?
The IUPAC name of (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol (CID 22806486) is (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol.
What is the SMILES notation for (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol?
The canonical SMILES for (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol is NCCC1=CC[C@@H](O)[C@@H](O)C1.
What is the InChIKey of (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol?
The InChIKey is CTFLQTXFACAEGL-SFYZADRCSA-N. The full InChI is InChI=1S/C8H15NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1,7-8,10-11H,2-5,9H2/t7-,8+/m1/s1.
What are the key properties of (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol?
(1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol has a molecular weight of 157.21 g/mol, XLogP of -0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-4-(2-aminoethyl)cyclohex-4-ene-1,2-diol is sourced from PubChem (CID 22806486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).