C18H20BrNO — CID 22806575
(4aR,10bS)-6-phenyl-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[3,4-c]pyridine;hydrobromide (PubChem CID 22806575) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is (4aR,10bS)-6-phenyl-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[3,4-c]pyridine;hydrobromide.
| Compound Name | (4aR,10bS)-6-phenyl-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[3,4-c]pyridine;hydrobromide |
|---|---|
| PubChem CID | 22806575 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (4aR,10bS)-6-phenyl-2,3,4,4a,6,10b-hexahydro-1H-isochromeno[3,4-c]pyridine;hydrobromide |
| SMILES | Br.c1ccc(C2O[C@H]3CNCC[C@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H19NO.BrH/c1-2-6-13(7-3-1)18-16-9-5-4-8-14(16)15-10-11-19-12-17(15)20-18;/h1-9,15,17-19H,10-12H2;1H/t15-,17-,18?;/m0./s1 |
| InChIKey | BIWLTPHKUFHWBB-BJXIUANTSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |