C13H22O7 — CID 22806638
ethyl 2-[(1S,3R,4R,5S)-3-[(1R)-1,2-dihydroxyethyl]-1,5-dihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-4-yl]acetate (PubChem CID 22806638) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is ethyl 2-[(1S,3R,4R,5S)-3-[(1R)-1,2-dihydroxyethyl]-1,5-dihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-4-yl]acetate.
| Compound Name | ethyl 2-[(1S,3R,4R,5S)-3-[(1R)-1,2-dihydroxyethyl]-1,5-dihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-4-yl]acetate |
|---|---|
| PubChem CID | 22806638 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl 2-[(1S,3R,4R,5S)-3-[(1R)-1,2-dihydroxyethyl]-1,5-dihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@H]([C@H](O)CO)O[C@@]2(O)C(C)(C)[C@@]12O |
| InChI | InChI=1S/C13H22O7/c1-4-19-9(16)5-7-10(8(15)6-14)20-13(18)11(2,3)12(7,13)17/h7-8,10,14-15,17-18H,4-6H2,1-3H3/t7-,8-,10-,12+,13+/m1/s1 |
| InChIKey | NJJLTGOGKHIQAG-PAMYDDKSSA-N |
| XLogP | -1.23 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |