C17H26O9 — CID 22806641
ethyl 2-[(3aR,5S,6R,6aR)-5-[(1R)-1,2-diacetyloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 22806641) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is ethyl 2-[(3aR,5S,6R,6aR)-5-[(1R)-1,2-diacetyloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,5S,6R,6aR)-5-[(1R)-1,2-diacetyloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 22806641 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 2-[(3aR,5S,6R,6aR)-5-[(1R)-1,2-diacetyloxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H26O9/c1-6-21-13(20)7-11-14(12(23-10(3)19)8-22-9(2)18)24-16-15(11)25-17(4,5)26-16/h11-12,14-16H,6-8H2,1-5H3/t11-,12-,14+,15-,16-/m1/s1 |
| InChIKey | PNPWTRCWTACPCA-HUHANWACSA-N |
| XLogP | 0.93 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|