C14H23N3O2 — CID 22806968
(E)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoic acid (PubChem CID 22806968) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (E)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 22806968 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (E)-2-cyano-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoic acid |
| SMILES | C/C(NC1CC(C)(C)NC(C)(C)C1)=C(/C#N)C(=O)O |
| InChI | InChI=1S/C14H23N3O2/c1-9(11(8-15)12(18)19)16-10-6-13(2,3)17-14(4,5)7-10/h10,16-17H,6-7H2,1-5H3,(H,18,19)/b11-9+ |
| InChIKey | AFBIPXNMWQXQBB-PKNBQFBNSA-N |
| XLogP | 1.77 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|