C11H14N4O5 — CID 22807145
(3aR,7aR)-3-(1-methyl-5-nitroimidazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole-6,7-diol (PubChem CID 22807145) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is (3aR,7aR)-3-(1-methyl-5-nitroimidazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole-6,7-diol.
| Compound Name | (3aR,7aR)-3-(1-methyl-5-nitroimidazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole-6,7-diol |
|---|---|
| PubChem CID | 22807145 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (3aR,7aR)-3-(1-methyl-5-nitroimidazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole-6,7-diol |
| SMILES | Cn1c([N+](=O)[O-])cnc1C1=NO[C@H]2C(O)C(O)CC[C@H]12 |
| InChI | InChI=1S/C11H14N4O5/c1-14-7(15(18)19)4-12-11(14)8-5-2-3-6(16)9(17)10(5)20-13-8/h4-6,9-10,16-17H,2-3H2,1H3/t5-,6?,9?,10-/m1/s1 |
| InChIKey | ZAYDDXBAZPKGDR-ANUOFRBBSA-N |
| XLogP | -0.44 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|